polyphosphoric acid CAS#8017-16-1
Payment Terms: T/T only for orders. Please contact us for detailed payment terms and order requirements.
High Purity and Polymerized Acid Properties: Consists of polymerized phosphoric acid and offers enhanced acid characteristics compared with conventional phosphoric acid.
Excellent Solubility and Hydrolysis Performance: Is highly hygroscopic, miscible with water, and hydrolyzes into orthophosphoric acid without crystallization.
Adjustable Viscosity Characteristics: Exhibits viscosity that varies with concentration and can be reduced through heating, providing flexibility for different industrial processes.
Versatile Industrial Application Potential: Its strong acidity and chemical reactivity make it suitable for use in various chemical synthesis and industrial applications.
Products Description of Polyphosphoric Acid CAS#8017-16-1
Polyphosphoric acid is a polymerized form of phosphoric acid. Generally, phosphoric acid with a purity of 100% or higher is referred to as polyphosphoric acid. It appears as a colorless, transparent, viscous liquid, with viscosity increasing as the concentration rises. At a concentration of 115%, it exhibits a glassy and highly viscous state.
Heating can effectively reduce the viscosity of polyphosphoric acid, allowing improved fluidity for certain industrial applications. At room temperature, it presents as a transparent, syrup-like liquid, while at lower temperatures it can transform into a solid, glassy material.
Polyphosphoric acid is a corrosive diprotic inorganic acid with strong hygroscopic properties. It is readily miscible with water and hydrolyzes to form orthophosphoric acid without crystallization. Due to its corrosive nature, appropriate handling measures are required during use.
| English Name | polyphosphoric acid |
| English Synonyms | acidesuperphosphorique;condensedphosphoricacid;condensedphosphoricacid(non-specificname);Polypho sphoric acid joyce;Phosphoric acids, super- or poly-;Polyphosphoric acid, > 84% phosphate (as P205), pure;POLYPHOSPHORIC ACID, 84% MIN.;Polyphosphorsuren |
| CAS Number | 8017-16-1 |
| Molecular Formula | (H)n+2.(P)n.(O)3n+1 |
| Molecular Weight | 0 |
| EINECS Number | 232-417-0 |
| Melting point | -20°C |
| Boiling point | 550℃ |
| Density | 2.06 g/mL at 25°C |
| Vapor pressure | 2 hPa (20 °C) |
| Storage conditions | Store below +30°C. |
| Solubility | Methanol (soluble), water (soluble) |
| Form | Viscous liquid |
| Acidity coefficient (pKa) | 0.91[at 20 ℃] |
| Specific gravity | 2.06 |
| Color | colorless |
| Odor | Odorless |
| Water solubility | MAY DECOMPOSE |
| Sensitivity | Hygroscopic |
| Merck | 147,580 |
| Stability | Stable. Incompatible with strong alkalis. Hygroscopic. |
| InChI | 1S/O5P2.H3O4P/c1-2-7-4-3-6(1)5-7;1-5(2,3)4/h;(H3,1,2,3,4) |
| InChIKey | FVYIVXLIMHNYTD-UHFFFAOYSA-N |
| Smiles | [P](=O)(O)(O)O.[p]21[o][p]([o][o]2)[o][o]1 |
![3-[(2-AMINOETHYL)AMINO]PROPANESULFONIC ACID CAS#14235-54-2](https://cdn.basfsd.com/cdn/ff/7JZIqcPTPQbPrQ5dzu3FwDFEMYGgNvSTwiYhim06DeI/1785327447/public/styles/chanpinzhanshitu_caijian/public/2026-01/%E4%B8%BB%E5%9B%BE%20%283%29_6.jpg?itok=1zuHGYYh)
