Diethyl ethoxymethylenemalonate CAS#87-13-8
Stable Chemical Performance: The compound maintains stable properties under normal conditions, making it suitable for controlled industrial applications.
Combustible Liquid Characteristics: As a combustible liquid, it can be utilized in processes requiring liquid organic materials with specific combustion properties.
Versatile Industrial Applicability: Its physical and chemical characteristics allow it to serve as a useful material in various chemical and industrial processes.
Suitable for Controlled Handling and Processing: With proper safety measures, the compound can be effectively managed and applied in professional industrial environments.
Diethyl Ethoxymethylenemalonate CAS#87-13-8
Diethyl ethoxymethylenemalonate is a combustible liquid that exhibits moderate toxicity when ingested and may cause skin irritation upon contact. Under conditions of thermal decomposition, it releases acrid smoke and irritating fumes.
Diethyl ethoxymethylenemalonate Chemical Properties
| Melting point | -33°C |
| Boiling point | 279-283 °C(lit.) |
| density | 1.080 g/mL at 20 °C(lit.) |
| vapor pressure | <0.1 hPa |
| refractive index | n20/D 1.463 |
| Fp | 311 °F |
| storage temp. | Store below +30°C. |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Liquid |
| color | Clear colorless to light yellow |
| Water Solubility | insoluble |
| BRN | 880058 |
| InChI | 1S/C10H16O5/c1-4-13-7-8(9(11)14-5-2)10(12)15-6-3/h7H,4-6H2,1-3H3 |
| InChIKey | LTMHNWPUDSTBKD-UHFFFAOYSA-N |
| SMILES | CCO\C=C(\C(=O)OCC)C(=O)OCC |
| LogP | 1.5-2.1 at pH7 |
| CAS DataBase Reference | 87-13-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Propanedioic acid, (ethoxymethylene)-, diethyl ester(87-13-8) |
| EPA Substance Registry System | Propanedioic acid, (ethoxymethylene)-, diethyl ester (87-13-8) |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38-42/43 |
| Safety Statements | 26-36/37/39-27-24/25 |
| WGK Germany | 1 |
| RTECS | OO1100000 |
| Autoignition Temperature | 215 °C |
| TSCA | TSCA listed |
| HS Code | 29189090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Aquatic Acute 1 | |
| Aquatic Chronic 2 | |
| Eye Irrit. 2 | |
| Skin Irrit. 2 | |
| Skin Sens. 1A | |
| Toxicity | LD50 orally in Rabbit: 925 mg/kg LD50 dermal Rat > 2000 mg/kg |
Product Application of Diethyl Ethoxymethylenemalonate CAS#87-13-8
Diethyl ethoxymethylenemalonate is widely used as an important intermediate in organic synthesis, including the preparation of pyrido[3,2-e]pyrimido[1,2-c]pyrimidine derivatives. It was initially applied in the monitoring of lysine decarboxylase activity and is also useful for amino acid analysis through precolumn derivatization using reversed-phase high-performance liquid chromatography (HPLC).
This compound plays a significant role in the Gould-Jacobs reaction for quinoline synthesis. For example, its reaction with aniline produces 4-hydroxyquinoline. It also serves as an intermediate in the synthesis of flumequine, a fluoroquinolone antibiotic.
